C17H29NaO5Si — CID 58681993
sodium (1S,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-methoxycarbonyl-1,6-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 58681993) has the molecular formula C17H29NaO5Si and a molecular weight of 364.49 g/mol. Its IUPAC name is sodium (1S,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-methoxycarbonyl-1,6-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | sodium (1S,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-methoxycarbonyl-1,6-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 58681993 |
| Molecular Formula | C17H29NaO5Si |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | sodium (1S,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-methoxycarbonyl-1,6-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C17H30O5Si.Na/c1-15(2,3)23(7,8)22-12-10-9-11-16(4,14(20)21-6)17(12,5)13(18)19;/h9-10,12H,11H2,1-8H3,(H,18,19);/q;+1/p-1/t12-,16+,17-;/m0./s1 |
| InChIKey | DFYJAHLDLLMYOM-RXLRPHPKSA-M |
| XLogP | -0.72 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|