C16H20O4 — CID 58681995
(1R,2S,6R,7R,8R)-2,6,7-trimethyl-14-methylidene-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione (PubChem CID 58681995) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (1R,2S,6R,7R,8R)-2,6,7-trimethyl-14-methylidene-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione.
| Compound Name | (1R,2S,6R,7R,8R)-2,6,7-trimethyl-14-methylidene-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione |
|---|---|
| PubChem CID | 58681995 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (1R,2S,6R,7R,8R)-2,6,7-trimethyl-14-methylidene-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione |
| SMILES | C=C1CC[C@@]23OC(=O)C[C@@]12[C@@H](C)[C@@]1(C)C(=O)OC[C@@]31C |
| InChI | InChI=1S/C16H20O4/c1-9-5-6-16-13(3)8-19-12(18)14(13,4)10(2)15(9,16)7-11(17)20-16/h10H,1,5-8H2,2-4H3/t10-,13+,14-,15-,16-/m0/s1 |
| InChIKey | XQACZEVZORQESJ-MNNDFKHZSA-N |
| XLogP | 2.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|