C17H30O6Si — CID 58681998
(1S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxycarbonyl-1,6-dimethylcyclohex-3-ene-1-carboperoxoic acid (PubChem CID 58681998) has the molecular formula C17H30O6Si and a molecular weight of 358.51 g/mol. Its IUPAC name is (1S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxycarbonyl-1,6-dimethylcyclohex-3-ene-1-carboperoxoic acid.
| Compound Name | (1S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxycarbonyl-1,6-dimethylcyclohex-3-ene-1-carboperoxoic acid |
|---|---|
| PubChem CID | 58681998 |
| Molecular Formula | C17H30O6Si |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (1S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxycarbonyl-1,6-dimethylcyclohex-3-ene-1-carboperoxoic acid |
| SMILES | COC(=O)[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)C=CC[C@]1(C)C(=O)OO |
| InChI | InChI=1S/C17H30O6Si/c1-15(2,3)24(7,8)23-12-10-9-11-16(4,13(18)22-20)17(12,5)14(19)21-6/h9-10,12,20H,11H2,1-8H3/t12-,16+,17-/m0/s1 |
| InChIKey | NOKGHMCAUHWADO-VUCTXSBTSA-N |
| XLogP | 3.54 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|