C17H32O4Si — CID 58682000
methyl (1S,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-1,6-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 58682000) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is methyl (1S,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-1,6-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-1,6-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 58682000 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | methyl (1S,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-1,6-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)C=CC[C@]1(C)CO |
| InChI | InChI=1S/C17H32O4Si/c1-15(2,3)22(7,8)21-13-10-9-11-16(4,12-18)17(13,5)14(19)20-6/h9-10,13,18H,11-12H2,1-8H3/t13-,16+,17-/m0/s1 |
| InChIKey | BYQGFKXLIVWKAU-XKQJLSEDSA-N |
| XLogP | 3.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|