C20H28Si — CID 58682043
[(1S,7aS)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilane (PubChem CID 58682043) has the molecular formula C20H28Si and a molecular weight of 296.53 g/mol. Its IUPAC name is [(1S,7aS)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilane.
| Compound Name | [(1S,7aS)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 58682043 |
| Molecular Formula | C20H28Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [(1S,7aS)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilane |
| SMILES | C[Si](C)(C1CCC2C=CC=CC21)[C@H]1CCC2C=CC=C[C@@H]21 |
| InChI | InChI=1S/C20H28Si/c1-21(2,19-13-11-15-7-3-5-9-17(15)19)20-14-12-16-8-4-6-10-18(16)20/h3-10,15-20H,11-14H2,1-2H3/t15?,16?,17-,18?,19-,20?/m0/s1 |
| InChIKey | KGICGFCXSNAXFE-QVAUGLRTSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|