C15H22N2O5 — CID 58682791
tert-butyl (3aS,4S,6S)-6-(cyanomethyl)-4-formyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 58682791) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is tert-butyl (3aS,4S,6S)-6-(cyanomethyl)-4-formyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,4S,6S)-6-(cyanomethyl)-4-formyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 58682791 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | tert-butyl (3aS,4S,6S)-6-(cyanomethyl)-4-formyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](C=O)[C@@H]2OC(C)(C)OC2[C@@H]1CC#N |
| InChI | InChI=1S/C15H22N2O5/c1-14(2,3)22-13(19)17-9(6-7-16)11-12(10(17)8-18)21-15(4,5)20-11/h8-12H,6H2,1-5H3/t9-,10+,11?,12-/m0/s1 |
| InChIKey | JOHOIQLLJCPQCL-MBYGNEARSA-N |
| XLogP | 1.61 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|