C16H26N2O4 — CID 58682802
tert-butyl (4S,6R,6aS)-4-(cyanomethyl)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 58682802) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is tert-butyl (4S,6R,6aS)-4-(cyanomethyl)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (4S,6R,6aS)-4-(cyanomethyl)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 58682802 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | tert-butyl (4S,6R,6aS)-4-(cyanomethyl)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC[C@@H]1[C@@H]2OC(C)(C)OC2[C@H](CC#N)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26N2O4/c1-7-10-12-13(21-16(5,6)20-12)11(8-9-17)18(10)14(19)22-15(2,3)4/h10-13H,7-8H2,1-6H3/t10-,11+,12+,13?/m1/s1 |
| InChIKey | FOBPZYWMVYGGGE-VHGBLZLWSA-N |
| XLogP | 2.82 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |