C26H54O3 — CID 58682911
3,5,5-trimethyl-1-[4-[4-(3,5,5-trimethylhexoxy)butoxy]butoxy]hexane (PubChem CID 58682911) has the molecular formula C26H54O3 and a molecular weight of 414.72 g/mol. Its IUPAC name is 3,5,5-trimethyl-1-[4-[4-(3,5,5-trimethylhexoxy)butoxy]butoxy]hexane.
| Compound Name | 3,5,5-trimethyl-1-[4-[4-(3,5,5-trimethylhexoxy)butoxy]butoxy]hexane |
|---|---|
| PubChem CID | 58682911 |
| Molecular Formula | C26H54O3 |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 414.41 |
| IUPAC Name | 3,5,5-trimethyl-1-[4-[4-(3,5,5-trimethylhexoxy)butoxy]butoxy]hexane |
| SMILES | CC(CCOCCCCOCCCCOCCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C26H54O3/c1-23(21-25(3,4)5)13-19-28-17-11-9-15-27-16-10-12-18-29-20-14-24(2)22-26(6,7)8/h23-24H,9-22H2,1-8H3 |
| InChIKey | ILPFXHXQILMHTE-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|