C12H24N2 — CID 58683666
(8aS)-2-tert-butyl-8a-methyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazine (PubChem CID 58683666) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (8aS)-2-tert-butyl-8a-methyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazine.
| Compound Name | (8aS)-2-tert-butyl-8a-methyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 58683666 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (8aS)-2-tert-butyl-8a-methyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazine |
| SMILES | CC(C)(C)N1CCN2CCC[C@@]2(C)C1 |
| InChI | InChI=1S/C12H24N2/c1-11(2,3)14-9-8-13-7-5-6-12(13,4)10-14/h5-10H2,1-4H3/t12-/m0/s1 |
| InChIKey | MBYPMQSLLSZZFR-LBPRGKRZSA-N |
| XLogP | 1.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |