C19H12ClF2N3O3 — CID 58683973
methyl 3-chloro-4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]benzoate (PubChem CID 58683973) has the molecular formula C19H12ClF2N3O3 and a molecular weight of 403.77 g/mol. Its IUPAC name is methyl 3-chloro-4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]benzoate.
| Compound Name | methyl 3-chloro-4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]benzoate |
|---|---|
| PubChem CID | 58683973 |
| Molecular Formula | C19H12ClF2N3O3 |
| Molecular Weight | 403.77 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | methyl 3-chloro-4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cnc(NC(=O)c3c(F)cccc3F)cn2)c(Cl)c1 |
| InChI | InChI=1S/C19H12ClF2N3O3/c1-28-19(27)10-5-6-11(12(20)7-10)15-8-24-16(9-23-15)25-18(26)17-13(21)3-2-4-14(17)22/h2-9H,1H3,(H,24,25,26) |
| InChIKey | PWHNDEKZPDWABW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.77 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |