About 2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate
2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate (PubChem CID 58683986) has the molecular formula C22H19F2N3O4
and a molecular weight of 427.41 g/mol. Its IUPAC name is 2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate.
Molecular Properties
| Compound Name | 2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate |
| PubChem CID | 58683986 |
| Molecular Formula | C22H19F2N3O4 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate |
| SMILES | COCCOC(=O)c1ccc(-c2cnc(NC(=O)c3c(F)cccc3F)cn2)c(C)c1 |
| InChI | InChI=1S/C22H19F2N3O4/c1-13-10-14(22(29)31-9-8-30-2)6-7-15(13)18-11-26-19(12-25-18)27-21(28)20-16(23)4-3-5-17(20)24/h3-7,10-12H,8-9H2,1-2H3,(H,26,27,28) |
| InChIKey | YYOHZXXANNDMQI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate?
The IUPAC name of 2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate (CID 58683986) is 2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate.
What is the SMILES notation for 2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate?
The canonical SMILES for 2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate is COCCOC(=O)c1ccc(-c2cnc(NC(=O)c3c(F)cccc3F)cn2)c(C)c1.
What is the InChIKey of 2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate?
The InChIKey is YYOHZXXANNDMQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F2N3O4/c1-13-10-14(22(29)31-9-8-30-2)6-7-15(13)18-11-26-19(12-25-18)27-21(28)20-16(23)4-3-5-17(20)24/h3-7,10-12H,8-9H2,1-2H3,(H,26,27,28).
What are the key properties of 2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate?
2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate has a molecular weight of 427.41 g/mol, XLogP of 3.79, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl 4-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-3-methylbenzoate is sourced from PubChem (CID 58683986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).