About 3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine
3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine (PubChem CID 58684401) has the molecular formula C7H14F3NO2S
and a molecular weight of 233.25 g/mol. Its IUPAC name is 3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine |
| PubChem CID | 58684401 |
| Molecular Formula | C7H14F3NO2S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine |
| SMILES | NCCCS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C7H14F3NO2S/c8-7(9,10)3-1-5-14(12,13)6-2-4-11/h1-6,11H2 |
| InChIKey | UAQMFULZZWGQLK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine?
The IUPAC name of 3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine (CID 58684401) is 3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine.
What is the SMILES notation for 3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine?
The canonical SMILES for 3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine is NCCCS(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of 3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine?
The InChIKey is UAQMFULZZWGQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F3NO2S/c8-7(9,10)3-1-5-14(12,13)6-2-4-11/h1-6,11H2.
What are the key properties of 3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine?
3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine has a molecular weight of 233.25 g/mol, XLogP of 1.09, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4,4-trifluorobutylsulfonyl)propan-1-amine is sourced from PubChem (CID 58684401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).