About 2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine
2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine (PubChem CID 58684409) has the molecular formula C6H9ClF3NOS
and a molecular weight of 235.66 g/mol. Its IUPAC name is 2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine.
Molecular Properties
| Compound Name | 2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine |
| PubChem CID | 58684409 |
| Molecular Formula | C6H9ClF3NOS |
| Molecular Weight | 235.66 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine |
| SMILES | NCCS(=O)C/C=C(\Cl)C(F)(F)F |
| InChI | InChI=1S/C6H9ClF3NOS/c7-5(6(8,9)10)1-3-13(12)4-2-11/h1H,2-4,11H2/b5-1- |
| InChIKey | SAAVIMPSRFYILT-KTAJNNJTSA-N |
| XLogP | 1.38 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.66 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine?
The IUPAC name of 2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine (CID 58684409) is 2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine.
What is the SMILES notation for 2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine?
The canonical SMILES for 2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine is NCCS(=O)C/C=C(\Cl)C(F)(F)F.
What is the InChIKey of 2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine?
The InChIKey is SAAVIMPSRFYILT-KTAJNNJTSA-N. The full InChI is InChI=1S/C6H9ClF3NOS/c7-5(6(8,9)10)1-3-13(12)4-2-11/h1H,2-4,11H2/b5-1-.
What are the key properties of 2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine?
2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine has a molecular weight of 235.66 g/mol, XLogP of 1.38, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-3-chloro-4,4,4-trifluorobut-2-enyl]sulfinylethanamine is sourced from PubChem (CID 58684409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).