C7H11F4NOS — CID 58684782
2-[(2,2,3,3-tetrafluorocyclobutyl)methylsulfinyl]ethanamine (PubChem CID 58684782) has the molecular formula C7H11F4NOS and a molecular weight of 233.23 g/mol. Its IUPAC name is 2-[(2,2,3,3-tetrafluorocyclobutyl)methylsulfinyl]ethanamine.
| Compound Name | 2-[(2,2,3,3-tetrafluorocyclobutyl)methylsulfinyl]ethanamine |
|---|---|
| PubChem CID | 58684782 |
| Molecular Formula | C7H11F4NOS |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2-[(2,2,3,3-tetrafluorocyclobutyl)methylsulfinyl]ethanamine |
| SMILES | NCCS(=O)CC1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C7H11F4NOS/c8-6(9)3-5(7(6,10)11)4-14(13)2-1-12/h5H,1-4,12H2 |
| InChIKey | SUYIXRONDNUQME-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|