C12H16N2O — CID 58684880
(2Z)-2-propan-2-yloxyimino-1,3-dihydroinden-1-amine (PubChem CID 58684880) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (2Z)-2-propan-2-yloxyimino-1,3-dihydroinden-1-amine.
| Compound Name | (2Z)-2-propan-2-yloxyimino-1,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 58684880 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (2Z)-2-propan-2-yloxyimino-1,3-dihydroinden-1-amine |
| SMILES | CC(C)O/N=C1/Cc2ccccc2C1N |
| InChI | InChI=1S/C12H16N2O/c1-8(2)15-14-11-7-9-5-3-4-6-10(9)12(11)13/h3-6,8,12H,7,13H2,1-2H3/b14-11- |
| InChIKey | MBBWRLMXTZGDLQ-KAMYIIQDSA-N |
| XLogP | 2.02 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|