About 3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine
3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine (PubChem CID 58684901) has the molecular formula C6H11Cl2NO2S
and a molecular weight of 232.13 g/mol. Its IUPAC name is 3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine |
| PubChem CID | 58684901 |
| Molecular Formula | C6H11Cl2NO2S |
| Molecular Weight | 232.13 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine |
| SMILES | NCCCS(=O)(=O)C/C(Cl)=C/Cl |
| InChI | InChI=1S/C6H11Cl2NO2S/c7-4-6(8)5-12(10,11)3-1-2-9/h4H,1-3,5,9H2/b6-4- |
| InChIKey | RVOLVLSWBNPBAC-XQRVVYSFSA-N |
| XLogP | 1.07 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.13 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine?
The IUPAC name of 3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine (CID 58684901) is 3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine.
What is the SMILES notation for 3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine?
The canonical SMILES for 3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine is NCCCS(=O)(=O)C/C(Cl)=C/Cl.
What is the InChIKey of 3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine?
The InChIKey is RVOLVLSWBNPBAC-XQRVVYSFSA-N. The full InChI is InChI=1S/C6H11Cl2NO2S/c7-4-6(8)5-12(10,11)3-1-2-9/h4H,1-3,5,9H2/b6-4-.
What are the key properties of 3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine?
3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine has a molecular weight of 232.13 g/mol, XLogP of 1.07, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-2,3-dichloroprop-2-enyl]sulfonylpropan-1-amine is sourced from PubChem (CID 58684901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).