C5H11F2NOS — CID 58684917
3-(2,2-difluoroethylsulfinyl)propan-1-amine (PubChem CID 58684917) has the molecular formula C5H11F2NOS and a molecular weight of 171.21 g/mol. Its IUPAC name is 3-(2,2-difluoroethylsulfinyl)propan-1-amine.
| Compound Name | 3-(2,2-difluoroethylsulfinyl)propan-1-amine |
|---|---|
| PubChem CID | 58684917 |
| Molecular Formula | C5H11F2NOS |
| Molecular Weight | 171.21 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 3-(2,2-difluoroethylsulfinyl)propan-1-amine |
| SMILES | NCCCS(=O)CC(F)F |
| InChI | InChI=1S/C5H11F2NOS/c6-5(7)4-10(9)3-1-2-8/h5H,1-4,8H2 |
| InChIKey | HNNPJOGGNKLHRB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |