C6H11Cl2NOS — CID 58685125
3-(3,3-dichloroprop-2-enylsulfinyl)propan-1-amine (PubChem CID 58685125) has the molecular formula C6H11Cl2NOS and a molecular weight of 216.13 g/mol. Its IUPAC name is 3-(3,3-dichloroprop-2-enylsulfinyl)propan-1-amine.
| Compound Name | 3-(3,3-dichloroprop-2-enylsulfinyl)propan-1-amine |
|---|---|
| PubChem CID | 58685125 |
| Molecular Formula | C6H11Cl2NOS |
| Molecular Weight | 216.13 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 3-(3,3-dichloroprop-2-enylsulfinyl)propan-1-amine |
| SMILES | NCCCS(=O)CC=C(Cl)Cl |
| InChI | InChI=1S/C6H11Cl2NOS/c7-6(8)2-5-11(10)4-1-3-9/h2H,1,3-5,9H2 |
| InChIKey | IULACGWSCDJRRZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.13 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |