C12H12F3NO — CID 58685234
4,5,6-trifluorospiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 58685234) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is 4,5,6-trifluorospiro[1H-2-benzofuran-3,4'-piperidine].
| Compound Name | 4,5,6-trifluorospiro[1H-2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 58685234 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 4,5,6-trifluorospiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | Fc1cc2c(c(F)c1F)C1(CCNCC1)OC2 |
| InChI | InChI=1S/C12H12F3NO/c13-8-5-7-6-17-12(1-3-16-4-2-12)9(7)11(15)10(8)14/h5,16H,1-4,6H2 |
| InChIKey | HDHUYHUPJHNYQU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|