C29H23NO8 — CID 58685328
12-(3,4-dimethoxyphenyl)-7,17-dihydroxy-8,16-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one (PubChem CID 58685328) has the molecular formula C29H23NO8 and a molecular weight of 513.50 g/mol. Its IUPAC name is 12-(3,4-dimethoxyphenyl)-7,17-dihydroxy-8,16-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one.
| Compound Name | 12-(3,4-dimethoxyphenyl)-7,17-dihydroxy-8,16-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
|---|---|
| PubChem CID | 58685328 |
| Molecular Formula | C29H23NO8 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 12-(3,4-dimethoxyphenyl)-7,17-dihydroxy-8,16-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
| SMILES | COc1cc2c(cc1O)oc(=O)c1c2c(-c2ccc(OC)c(OC)c2)c2c3cc(OC)c(O)cc3ccn21 |
| InChI | InChI=1S/C29H23NO8/c1-34-20-6-5-15(10-24(20)37-4)25-26-17-12-23(36-3)19(32)13-21(17)38-29(33)28(26)30-8-7-14-9-18(31)22(35-2)11-16(14)27(25)30/h5-13,31-32H,1-4H3 |
| InChIKey | YFXYEHRPPNIWJS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 112.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|