C33H34N4O5 — CID 58685747
N-[(1S)-3-[[(1S)-1-cyclopentyl-2-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-2-oxoethyl]amino]-3-oxo-1-phenylpropyl]-4-phenylpyridine-2-carboxamide (PubChem CID 58685747) has the molecular formula C33H34N4O5 and a molecular weight of 566.66 g/mol. Its IUPAC name is N-[(1S)-3-[[(1S)-1-cyclopentyl-2-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-2-oxoethyl]amino]-3-oxo-1-phenylpropyl]-4-phenylpyridine-2-carboxamide.
| Compound Name | N-[(1S)-3-[[(1S)-1-cyclopentyl-2-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-2-oxoethyl]amino]-3-oxo-1-phenylpropyl]-4-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 58685747 |
| Molecular Formula | C33H34N4O5 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | N-[(1S)-3-[[(1S)-1-cyclopentyl-2-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-2-oxoethyl]amino]-3-oxo-1-phenylpropyl]-4-phenylpyridine-2-carboxamide |
| SMILES | C[C@@H]1C(=O)NC(=O)[C@H]1C(=O)[C@@H](NC(=O)C[C@H](NC(=O)c1cc(-c2ccccc2)ccn1)c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C33H34N4O5/c1-20-28(33(42)37-31(20)40)30(39)29(23-14-8-9-15-23)36-27(38)19-25(22-12-6-3-7-13-22)35-32(41)26-18-24(16-17-34-26)21-10-4-2-5-11-21/h2-7,10-13,16-18,20,23,25,28-29H,8-9,14-15,19H2,1H3,(H,35,41)(H,36,38)(H,37,40,42)/t20-,25-,28+,29-/m0/s1 |
| InChIKey | FKMSHQOYIBLSEL-ZUVRJUTJSA-N |
| XLogP | 3.76 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|