C31H27N9O4 — CID 58686176
6-N-[[2-(2-amino-3,4-dioxocyclobuten-1-yl)-1,3-dihydroisoindol-5-yl]methyl]-4-N-[(1S)-4-methyl-5-(1H-1,2,4-triazol-5-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide (PubChem CID 58686176) has the molecular formula C31H27N9O4 and a molecular weight of 589.62 g/mol. Its IUPAC name is 6-N-[[2-(2-amino-3,4-dioxocyclobuten-1-yl)-1,3-dihydroisoindol-5-yl]methyl]-4-N-[(1S)-4-methyl-5-(1H-1,2,4-triazol-5-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 6-N-[[2-(2-amino-3,4-dioxocyclobuten-1-yl)-1,3-dihydroisoindol-5-yl]methyl]-4-N-[(1S)-4-methyl-5-(1H-1,2,4-triazol-5-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 58686176 |
| Molecular Formula | C31H27N9O4 |
| Molecular Weight | 589.62 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | 6-N-[[2-(2-amino-3,4-dioxocyclobuten-1-yl)-1,3-dihydroisoindol-5-yl]methyl]-4-N-[(1S)-4-methyl-5-(1H-1,2,4-triazol-5-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
| SMILES | Cc1c(-c2ncn[nH]2)ccc2c1CC[C@@H]2NC(=O)c1cc(C(=O)NCc2ccc3c(c2)CN(c2c(N)c(=O)c2=O)C3)ncn1 |
| InChI | InChI=1S/C31H27N9O4/c1-15-19-6-7-22(21(19)5-4-20(15)29-36-14-37-39-29)38-31(44)24-9-23(34-13-35-24)30(43)33-10-16-2-3-17-11-40(12-18(17)8-16)26-25(32)27(41)28(26)42/h2-5,8-9,13-14,22H,6-7,10-12,32H2,1H3,(H,33,43)(H,38,44)(H,36,37,39)/t22-/m0/s1 |
| InChIKey | RKLARDUUHUARPQ-QFIPXVFZSA-N |
| XLogP | 1.62 |
| TPSA | 188.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.62 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|