C24H18N6O2 — CID 58686204
4-N-[(1R)-5-cyano-2,3-dihydro-1H-inden-1-yl]-6-N-[(3-isocyanophenyl)methyl]pyrimidine-4,6-dicarboxamide (PubChem CID 58686204) has the molecular formula C24H18N6O2 and a molecular weight of 422.45 g/mol. Its IUPAC name is 4-N-[(1R)-5-cyano-2,3-dihydro-1H-inden-1-yl]-6-N-[(3-isocyanophenyl)methyl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N-[(1R)-5-cyano-2,3-dihydro-1H-inden-1-yl]-6-N-[(3-isocyanophenyl)methyl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 58686204 |
| Molecular Formula | C24H18N6O2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 4-N-[(1R)-5-cyano-2,3-dihydro-1H-inden-1-yl]-6-N-[(3-isocyanophenyl)methyl]pyrimidine-4,6-dicarboxamide |
| SMILES | [C-]#[N+]c1cccc(CNC(=O)c2cc(C(=O)N[C@@H]3CCc4cc(C#N)ccc43)ncn2)c1 |
| InChI | InChI=1S/C24H18N6O2/c1-26-18-4-2-3-16(10-18)13-27-23(31)21-11-22(29-14-28-21)24(32)30-20-8-6-17-9-15(12-25)5-7-19(17)20/h2-5,7,9-11,14,20H,6,8,13H2,(H,27,31)(H,30,32)/t20-/m1/s1 |
| InChIKey | GAMCSOFZNJVGCK-HXUWFJFHSA-N |
| XLogP | 3.25 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|