About ethyl (4-nitrophenyl) carbonate
ethyl (4-nitrophenyl) carbonate (PubChem CID 586863) has the molecular formula C9H9NO5
and a molecular weight of 211.17 g/mol. Its IUPAC name is ethyl (4-nitrophenyl) carbonate.
Molecular Properties
| Compound Name | ethyl (4-nitrophenyl) carbonate |
| PubChem CID | 586863 |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | ethyl (4-nitrophenyl) carbonate |
| SMILES | CCOC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H9NO5/c1-2-14-9(11)15-8-5-3-7(4-6-8)10(12)13/h3-6H,2H2,1H3 |
| InChIKey | OFJLSOXXIMLDDL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze ethyl (4-nitrophenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4-nitrophenyl) carbonate?
The IUPAC name of ethyl (4-nitrophenyl) carbonate (CID 586863) is ethyl (4-nitrophenyl) carbonate.
What is the SMILES notation for ethyl (4-nitrophenyl) carbonate?
The canonical SMILES for ethyl (4-nitrophenyl) carbonate is CCOC(=O)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of ethyl (4-nitrophenyl) carbonate?
The InChIKey is OFJLSOXXIMLDDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO5/c1-2-14-9(11)15-8-5-3-7(4-6-8)10(12)13/h3-6H,2H2,1H3.
What are the key properties of ethyl (4-nitrophenyl) carbonate?
ethyl (4-nitrophenyl) carbonate has a molecular weight of 211.17 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4-nitrophenyl) carbonate is sourced from PubChem (CID 586863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).