C12H16KOS- — CID 58686593
potassium 1-(methanidylsulfinylmethyl)-3-(2-methylpropyl)benzene-6-ide (PubChem CID 58686593) has the molecular formula C12H16KOS- and a molecular weight of 247.42 g/mol. Its IUPAC name is potassium 1-(methanidylsulfinylmethyl)-3-(2-methylpropyl)benzene-6-ide.
| Compound Name | potassium 1-(methanidylsulfinylmethyl)-3-(2-methylpropyl)benzene-6-ide |
|---|---|
| PubChem CID | 58686593 |
| Molecular Formula | C12H16KOS- |
| Molecular Weight | 247.42 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | potassium 1-(methanidylsulfinylmethyl)-3-(2-methylpropyl)benzene-6-ide |
| SMILES | [CH2-]S(=O)Cc1[c-]ccc(CC(C)C)c1.[K+] |
| InChI | InChI=1S/C12H16OS.K/c1-10(2)7-11-5-4-6-12(8-11)9-14(3)13;/h4-5,8,10H,3,7,9H2,1-2H3;/q-2;+1 |
| InChIKey | DLPSSYNWAKRYCY-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.42 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|