C26H27N3OS — CID 58687364
2-[4-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3,4-dimethylthiophen-2-yl]-3,5,5-trimethylfuran-2-ylidene]propanedinitrile (PubChem CID 58687364) has the molecular formula C26H27N3OS and a molecular weight of 429.59 g/mol. Its IUPAC name is 2-[4-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3,4-dimethylthiophen-2-yl]-3,5,5-trimethylfuran-2-ylidene]propanedinitrile.
| Compound Name | 2-[4-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3,4-dimethylthiophen-2-yl]-3,5,5-trimethylfuran-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 58687364 |
| Molecular Formula | C26H27N3OS |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-[4-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3,4-dimethylthiophen-2-yl]-3,5,5-trimethylfuran-2-ylidene]propanedinitrile |
| SMILES | CC1=C(c2sc(/C=C/c3ccc(N(C)C)cc3)c(C)c2C)C(C)(C)OC1=C(C#N)C#N |
| InChI | InChI=1S/C26H27N3OS/c1-16-17(2)25(23-18(3)24(20(14-27)15-28)30-26(23,4)5)31-22(16)13-10-19-8-11-21(12-9-19)29(6)7/h8-13H,1-7H3/b13-10+ |
| InChIKey | XOYAUUSYNWEPRM-JLHYYAGUSA-N |
| XLogP | 6.48 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|