C36H25Br2NSi — CID 58687534
[4-(3,6-dibromocarbazol-9-yl)phenyl]-triphenylsilane (PubChem CID 58687534) has the molecular formula C36H25Br2NSi and a molecular weight of 659.50 g/mol. Its IUPAC name is [4-(3,6-dibromocarbazol-9-yl)phenyl]-triphenylsilane.
| Compound Name | [4-(3,6-dibromocarbazol-9-yl)phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 58687534 |
| Molecular Formula | C36H25Br2NSi |
| Molecular Weight | 659.50 g/mol |
| Exact Mass | 657.01 |
| IUPAC Name | [4-(3,6-dibromocarbazol-9-yl)phenyl]-triphenylsilane |
| SMILES | Brc1ccc2c(c1)c1cc(Br)ccc1n2-c1ccc([Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H25Br2NSi/c37-26-16-22-35-33(24-26)34-25-27(38)17-23-36(34)39(35)28-18-20-32(21-19-28)40(29-10-4-1-5-11-29,30-12-6-2-7-13-30)31-14-8-3-9-15-31/h1-25H |
| InChIKey | HHCRNUNLHTWLMP-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.50 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|