About 3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene
3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene (PubChem CID 586878) has the molecular formula C16H24S2
and a molecular weight of 280.50 g/mol. Its IUPAC name is 3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene.
Molecular Properties
| Compound Name | 3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene |
| PubChem CID | 586878 |
| Molecular Formula | C16H24S2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene |
| SMILES | C1CCC2=C(C1)CSCC1=C(CCCC1)CSC2 |
| InChI | InChI=1S/C16H24S2/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17-9-13(14)5-1/h1-12H2 |
| InChIKey | RLDQBKUYHDLBDD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene?
The IUPAC name of 3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene (CID 586878) is 3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene.
What is the SMILES notation for 3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene?
The canonical SMILES for 3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene is C1CCC2=C(C1)CSCC1=C(CCCC1)CSC2.
What is the InChIKey of 3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene?
The InChIKey is RLDQBKUYHDLBDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24S2/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17-9-13(14)5-1/h1-12H2.
What are the key properties of 3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene?
3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene has a molecular weight of 280.50 g/mol, XLogP of 5.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,12-dithiatricyclo[12.4.0.05,10]octadeca-1(14),5(10)-diene is sourced from PubChem (CID 586878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).