C11H20O2 — CID 58687838
trans-(1R,3R)-5-(2,2-dimethylpropylidene)cyclohexane-1,3-diol (PubChem CID 58687838) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is trans-(1R,3R)-5-(2,2-dimethylpropylidene)cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-(2,2-dimethylpropylidene)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 58687838 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | trans-(1R,3R)-5-(2,2-dimethylpropylidene)cyclohexane-1,3-diol |
| SMILES | CC(C)(C)C=C1C[C@@H](O)C[C@H](O)C1 |
| InChI | InChI=1S/C11H20O2/c1-11(2,3)7-8-4-9(12)6-10(13)5-8/h7,9-10,12-13H,4-6H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | FYNQKQRYFXVGRK-NXEZZACHSA-N |
| XLogP | 1.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|