About (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene
(7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene (PubChem CID 58687841) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene.
Molecular Properties
| Compound Name | (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene |
| PubChem CID | 58687841 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene |
| SMILES | C1=C[C@@]2(CCC1)CCCC1(C2)OCCO1 |
| InChI | InChI=1S/C13H20O2/c1-2-5-12(6-3-1)7-4-8-13(11-12)14-9-10-15-13/h2,5H,1,3-4,6-11H2/t12-/m1/s1 |
| InChIKey | IUJOENIKEHNZMH-GFCCVEGCSA-N |
| XLogP | 3.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene?
The IUPAC name of (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene (CID 58687841) is (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene.
What is the SMILES notation for (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene?
The canonical SMILES for (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene is C1=C[C@@]2(CCC1)CCCC1(C2)OCCO1.
What is the InChIKey of (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene?
The InChIKey is IUJOENIKEHNZMH-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H20O2/c1-2-5-12(6-3-1)7-4-8-13(11-12)14-9-10-15-13/h2,5H,1,3-4,6-11H2/t12-/m1/s1.
What are the key properties of (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene?
(7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene has a molecular weight of 208.30 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene is sourced from PubChem (CID 58687841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).