C16H9F3N2O4 — CID 58687911
4-[(1,3-dioxoisoindol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 58687911) has the molecular formula C16H9F3N2O4 and a molecular weight of 350.25 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 58687911 |
| Molecular Formula | C16H9F3N2O4 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(C(F)(F)F)cc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H9F3N2O4/c17-16(18,19)12-5-8(11(6-20-12)15(24)25)7-21-13(22)9-3-1-2-4-10(9)14(21)23/h1-6H,7H2,(H,24,25) |
| InChIKey | CVAXMIJRGKLVFF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|