C18H16Cl2FN3O2 — CID 58688078
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridin-2-amine (PubChem CID 58688078) has the molecular formula C18H16Cl2FN3O2 and a molecular weight of 396.25 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 58688078 |
| Molecular Formula | C18H16Cl2FN3O2 |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridin-2-amine |
| SMILES | Cc1noc(C)c1-c1cnc(N)c(OC(C)c2c(Cl)ccc(F)c2Cl)c1 |
| InChI | InChI=1S/C18H16Cl2FN3O2/c1-8-15(10(3)26-24-8)11-6-14(18(22)23-7-11)25-9(2)16-12(19)4-5-13(21)17(16)20/h4-7,9H,1-3H3,(H2,22,23) |
| InChIKey | HLEMAEZUPVJGFD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|