C26H27Cl2FN4O2 — CID 58688121
[4-[6-amino-5-[1-(3,6-dichloro-2-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-[(3R,5S)-3,5-dimethylpiperazin-1-yl]methanone (PubChem CID 58688121) has the molecular formula C26H27Cl2FN4O2 and a molecular weight of 517.43 g/mol. Its IUPAC name is [4-[6-amino-5-[1-(3,6-dichloro-2-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-[(3R,5S)-3,5-dimethylpiperazin-1-yl]methanone.
| Compound Name | [4-[6-amino-5-[1-(3,6-dichloro-2-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-[(3R,5S)-3,5-dimethylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 58688121 |
| Molecular Formula | C26H27Cl2FN4O2 |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | [4-[6-amino-5-[1-(3,6-dichloro-2-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-[(3R,5S)-3,5-dimethylpiperazin-1-yl]methanone |
| SMILES | CC(Oc1cc(-c2ccc(C(=O)N3C[C@@H](C)N[C@@H](C)C3)cc2)cnc1N)c1c(Cl)ccc(Cl)c1F |
| InChI | InChI=1S/C26H27Cl2FN4O2/c1-14-12-33(13-15(2)32-14)26(34)18-6-4-17(5-7-18)19-10-22(25(30)31-11-19)35-16(3)23-20(27)8-9-21(28)24(23)29/h4-11,14-16,32H,12-13H2,1-3H3,(H2,30,31)/t14-,15+,16? |
| InChIKey | AUUODHBTVGDYCF-XYPWUTKMSA-N |
| XLogP | 5.74 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|