C24H26Cl2FN5O2 — CID 58688138
4-[[[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]amino]methyl]piperidin-4-ol (PubChem CID 58688138) has the molecular formula C24H26Cl2FN5O2 and a molecular weight of 506.41 g/mol. Its IUPAC name is 4-[[[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]amino]methyl]piperidin-4-ol.
| Compound Name | 4-[[[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]amino]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 58688138 |
| Molecular Formula | C24H26Cl2FN5O2 |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 4-[[[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]amino]methyl]piperidin-4-ol |
| SMILES | CC(Oc1cc(-c2ccc(NCC3(O)CCNCC3)nc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C24H26Cl2FN5O2/c1-14(21-17(25)3-4-18(27)22(21)26)34-19-10-16(12-31-23(19)28)15-2-5-20(30-11-15)32-13-24(33)6-8-29-9-7-24/h2-5,10-12,14,29,33H,6-9,13H2,1H3,(H2,28,31)(H,30,32) |
| InChIKey | FTDXMDPCBAJDJY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|