C23H24Cl2FN5O — CID 58688199
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[6-(piperidin-4-ylamino)-3-pyridinyl]pyridin-2-amine (PubChem CID 58688199) has the molecular formula C23H24Cl2FN5O and a molecular weight of 476.38 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[6-(piperidin-4-ylamino)-3-pyridinyl]pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[6-(piperidin-4-ylamino)-3-pyridinyl]pyridin-2-amine |
|---|---|
| PubChem CID | 58688199 |
| Molecular Formula | C23H24Cl2FN5O |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[6-(piperidin-4-ylamino)-3-pyridinyl]pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2ccc(NC3CCNCC3)nc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C23H24Cl2FN5O/c1-13(21-17(24)3-4-18(26)22(21)25)32-19-10-15(12-30-23(19)27)14-2-5-20(29-11-14)31-16-6-8-28-9-7-16/h2-5,10-13,16,28H,6-9H2,1H3,(H2,27,30)(H,29,31) |
| InChIKey | RMFBJBWWJIPATG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|