C14H19N3O — CID 58688252
(2R,5aR)-2,8-dimethyl-2,3,4,5,5a,6-hexahydro-1H-[1,4]diazepino[1,7-a]quinazolin-7-one (PubChem CID 58688252) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is (2R,5aR)-2,8-dimethyl-2,3,4,5,5a,6-hexahydro-1H-[1,4]diazepino[1,7-a]quinazolin-7-one.
| Compound Name | (2R,5aR)-2,8-dimethyl-2,3,4,5,5a,6-hexahydro-1H-[1,4]diazepino[1,7-a]quinazolin-7-one |
|---|---|
| PubChem CID | 58688252 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | (2R,5aR)-2,8-dimethyl-2,3,4,5,5a,6-hexahydro-1H-[1,4]diazepino[1,7-a]quinazolin-7-one |
| SMILES | Cc1cccc2c1C(=O)N[C@H]1CCN[C@H](C)CN21 |
| InChI | InChI=1S/C14H19N3O/c1-9-4-3-5-11-13(9)14(18)16-12-6-7-15-10(2)8-17(11)12/h3-5,10,12,15H,6-8H2,1-2H3,(H,16,18)/t10-,12-/m1/s1 |
| InChIKey | DPGOGRGOBASJRU-ZYHUDNBSSA-N |
| XLogP | 1.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |