C20H22N6OS — CID 58688483
2-[2-(2-methoxyethylamino)-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]pyrimidin-4-yl]benzonitrile (PubChem CID 58688483) has the molecular formula C20H22N6OS and a molecular weight of 394.50 g/mol. Its IUPAC name is 2-[2-(2-methoxyethylamino)-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]pyrimidin-4-yl]benzonitrile.
| Compound Name | 2-[2-(2-methoxyethylamino)-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 58688483 |
| Molecular Formula | C20H22N6OS |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-[2-(2-methoxyethylamino)-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]pyrimidin-4-yl]benzonitrile |
| SMILES | COCCNc1nc(-c2cnc(NC(C)C)s2)cc(-c2ccccc2C#N)n1 |
| InChI | InChI=1S/C20H22N6OS/c1-13(2)24-20-23-12-18(28-20)17-10-16(15-7-5-4-6-14(15)11-21)25-19(26-17)22-8-9-27-3/h4-7,10,12-13H,8-9H2,1-3H3,(H,23,24)(H,22,25,26) |
| InChIKey | FQRUKCFPQIVAHH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|