C19H20F3N3O3S — CID 58688758
2-[methyl-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]amino]-1,3-thiazole-5-carbaldehyde (PubChem CID 58688758) has the molecular formula C19H20F3N3O3S and a molecular weight of 427.45 g/mol. Its IUPAC name is 2-[methyl-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]amino]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[methyl-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]amino]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 58688758 |
| Molecular Formula | C19H20F3N3O3S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[methyl-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]amino]-1,3-thiazole-5-carbaldehyde |
| SMILES | CCCc1c(OCCCN(C)c2ncc(C=O)s2)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C19H20F3N3O3S/c1-3-5-13-15(7-6-14-16(13)28-24-17(14)19(20,21)22)27-9-4-8-25(2)18-23-10-12(11-26)29-18/h6-7,10-11H,3-5,8-9H2,1-2H3 |
| InChIKey | WJPZEHGFROVGFQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|