C14H12F2O2S — CID 58688870
2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole (PubChem CID 58688870) has the molecular formula C14H12F2O2S and a molecular weight of 282.31 g/mol. Its IUPAC name is 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole.
| Compound Name | 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 58688870 |
| Molecular Formula | C14H12F2O2S |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole |
| SMILES | CC(C)c1ccc(-c2ccc3c(c2)OC(F)(F)O3)s1 |
| InChI | InChI=1S/C14H12F2O2S/c1-8(2)12-5-6-13(19-12)9-3-4-10-11(7-9)18-14(15,16)17-10/h3-8H,1-2H3 |
| InChIKey | SBEKFUOTYRGYED-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |