About 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole
2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole (PubChem CID 58688870) has the molecular formula C14H12F2O2S
and a molecular weight of 282.31 g/mol. Its IUPAC name is 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole.
Molecular Properties
| Compound Name | 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole |
| PubChem CID | 58688870 |
| Molecular Formula | C14H12F2O2S |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole |
| SMILES | CC(C)c1ccc(-c2ccc3c(c2)OC(F)(F)O3)s1 |
| InChI | InChI=1S/C14H12F2O2S/c1-8(2)12-5-6-13(19-12)9-3-4-10-11(7-9)18-14(15,16)17-10/h3-8H,1-2H3 |
| InChIKey | SBEKFUOTYRGYED-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole?
The IUPAC name of 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole (CID 58688870) is 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole.
What is the SMILES notation for 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole?
The canonical SMILES for 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole is CC(C)c1ccc(-c2ccc3c(c2)OC(F)(F)O3)s1.
What is the InChIKey of 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole?
The InChIKey is SBEKFUOTYRGYED-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2O2S/c1-8(2)12-5-6-13(19-12)9-3-4-10-11(7-9)18-14(15,16)17-10/h3-8H,1-2H3.
What are the key properties of 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole?
2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole has a molecular weight of 282.31 g/mol, XLogP of 4.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-5-(5-propan-2-ylthiophen-2-yl)-1,3-benzodioxole is sourced from PubChem (CID 58688870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).