C12H21N3S6 — CID 58689487
2,4,6-tris(2-methylsulfanylethylsulfanyl)-1,3,5-triazine (PubChem CID 58689487) has the molecular formula C12H21N3S6 and a molecular weight of 399.72 g/mol. Its IUPAC name is 2,4,6-tris(2-methylsulfanylethylsulfanyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(2-methylsulfanylethylsulfanyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58689487 |
| Molecular Formula | C12H21N3S6 |
| Molecular Weight | 399.72 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 2,4,6-tris(2-methylsulfanylethylsulfanyl)-1,3,5-triazine |
| SMILES | CSCCSc1nc(SCCSC)nc(SCCSC)n1 |
| InChI | InChI=1S/C12H21N3S6/c1-16-4-7-19-10-13-11(20-8-5-17-2)15-12(14-10)21-9-6-18-3/h4-9H2,1-3H3 |
| InChIKey | YCJJDQMOCLTEEA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.72 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|