C12H21N3S3 — CID 58689492
2,4,6-tris(propylsulfanyl)-1,3,5-triazine (PubChem CID 58689492) has the molecular formula C12H21N3S3 and a molecular weight of 303.52 g/mol. Its IUPAC name is 2,4,6-tris(propylsulfanyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(propylsulfanyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58689492 |
| Molecular Formula | C12H21N3S3 |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2,4,6-tris(propylsulfanyl)-1,3,5-triazine |
| SMILES | CCCSc1nc(SCCC)nc(SCCC)n1 |
| InChI | InChI=1S/C12H21N3S3/c1-4-7-16-10-13-11(17-8-5-2)15-12(14-10)18-9-6-3/h4-9H2,1-3H3 |
| InChIKey | NKEFCAXABOXPEP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |