C30H22F6O9S2 — CID 58690093
5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]phenoxy]-3-(trioxidanylsulfanyl)benzoyl]-2-methylbenzenesulfonic acid (PubChem CID 58690093) has the molecular formula C30H22F6O9S2 and a molecular weight of 704.62 g/mol. Its IUPAC name is 5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]phenoxy]-3-(trioxidanylsulfanyl)benzoyl]-2-methylbenzenesulfonic acid.
| Compound Name | 5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]phenoxy]-3-(trioxidanylsulfanyl)benzoyl]-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 58690093 |
| Molecular Formula | C30H22F6O9S2 |
| Molecular Weight | 704.62 g/mol |
| Exact Mass | 704.06 |
| IUPAC Name | 5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]phenoxy]-3-(trioxidanylsulfanyl)benzoyl]-2-methylbenzenesulfonic acid |
| SMILES | COc1ccc(C(c2ccc(Oc3ccc(C(=O)c4ccc(C)c(S(=O)(=O)O)c4)cc3SOOO)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H22F6O9S2/c1-17-3-4-19(16-26(17)47(39,40)41)27(37)18-5-14-24(25(15-18)46-45-44-38)43-23-12-8-21(9-13-23)28(29(31,32)33,30(34,35)36)20-6-10-22(42-2)11-7-20/h3-16,38H,1-2H3,(H,39,40,41) |
| InChIKey | MIDQOHRVIZXNOG-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.62 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|