C15H16F7Y- — CID 58690121
[3,5,7,7,7-pentafluoro-4,6-bis(fluoromethyl)heptan-3-yl]benzene;yttrium (PubChem CID 58690121) has the molecular formula C15H16F7Y- and a molecular weight of 418.19 g/mol. Its IUPAC name is [3,5,7,7,7-pentafluoro-4,6-bis(fluoromethyl)heptan-3-yl]benzene;yttrium.
| Compound Name | [3,5,7,7,7-pentafluoro-4,6-bis(fluoromethyl)heptan-3-yl]benzene;yttrium |
|---|---|
| PubChem CID | 58690121 |
| Molecular Formula | C15H16F7Y- |
| Molecular Weight | 418.19 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | [3,5,7,7,7-pentafluoro-4,6-bis(fluoromethyl)heptan-3-yl]benzene;yttrium |
| SMILES | CCC(F)(c1cc[c-]cc1)C(CF)C(F)C(CF)C(F)(F)F.[Y] |
| InChI | InChI=1S/C15H16F7.Y/c1-2-14(19,10-6-4-3-5-7-10)11(8-16)13(18)12(9-17)15(20,21)22;/h4-7,11-13H,2,8-9H2,1H3;/q-1; |
| InChIKey | MSXSJJFSAVJPQF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.19 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|