C30H22F8O4S — CID 58690163
1,2,4,5-tetrafluoro-3-methyl-6-[2,3,5,6-tetrafluoro-4-[4-(4-methoxy-3,5-dimethylphenyl)sulfonyl-2,6-dimethylphenoxy]phenyl]benzene (PubChem CID 58690163) has the molecular formula C30H22F8O4S and a molecular weight of 630.55 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-methyl-6-[2,3,5,6-tetrafluoro-4-[4-(4-methoxy-3,5-dimethylphenyl)sulfonyl-2,6-dimethylphenoxy]phenyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-methyl-6-[2,3,5,6-tetrafluoro-4-[4-(4-methoxy-3,5-dimethylphenyl)sulfonyl-2,6-dimethylphenoxy]phenyl]benzene |
|---|---|
| PubChem CID | 58690163 |
| Molecular Formula | C30H22F8O4S |
| Molecular Weight | 630.55 g/mol |
| Exact Mass | 630.11 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-methyl-6-[2,3,5,6-tetrafluoro-4-[4-(4-methoxy-3,5-dimethylphenyl)sulfonyl-2,6-dimethylphenoxy]phenyl]benzene |
| SMILES | COc1c(C)cc(S(=O)(=O)c2cc(C)c(Oc3c(F)c(F)c(-c4c(F)c(F)c(C)c(F)c4F)c(F)c3F)c(C)c2)cc1C |
| InChI | InChI=1S/C30H22F8O4S/c1-11-7-16(8-12(2)28(11)41-6)43(39,40)17-9-13(3)29(14(4)10-17)42-30-26(37)24(35)19(25(36)27(30)38)18-22(33)20(31)15(5)21(32)23(18)34/h7-10H,1-6H3 |
| InChIKey | LKLHGYSFNZTSMO-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.55 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|