About 1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate
1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate (PubChem CID 58690258) has the molecular formula C15H24N8O6
and a molecular weight of 412.41 g/mol. Its IUPAC name is 1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate.
Molecular Properties
| Compound Name | 1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate |
| PubChem CID | 58690258 |
| Molecular Formula | C15H24N8O6 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate |
| SMILES | [N-]=[N+]=NCCOCCOCC(COCCOCCN=[N+]=[N-])OC(=O)n1ccnc1 |
| InChI | InChI=1S/C15H24N8O6/c16-21-19-2-5-25-7-9-27-11-14(29-15(24)23-4-1-18-13-23)12-28-10-8-26-6-3-20-22-17/h1,4,13-14H,2-3,5-12H2 |
| InChIKey | KVMLOHMGWMJBII-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 178.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate?
The IUPAC name of 1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate (CID 58690258) is 1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate.
What is the SMILES notation for 1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate?
The canonical SMILES for 1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate is [N-]=[N+]=NCCOCCOCC(COCCOCCN=[N+]=[N-])OC(=O)n1ccnc1.
What is the InChIKey of 1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate?
The InChIKey is KVMLOHMGWMJBII-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N8O6/c16-21-19-2-5-25-7-9-27-11-14(29-15(24)23-4-1-18-13-23)12-28-10-8-26-6-3-20-22-17/h1,4,13-14H,2-3,5-12H2.
What are the key properties of 1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate?
1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate has a molecular weight of 412.41 g/mol, XLogP of 1.92, 17 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[2-(2-azidoethoxy)ethoxy]propan-2-yl imidazole-1-carboxylate is sourced from PubChem (CID 58690258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).