C72H76N2 — CID 58690841
N-[4-[6-[4-(4-cyclohexyl-N-(2,4-dimethylphenyl)anilino)phenyl]-9,10-di(propan-2-yl)anthracen-2-yl]phenyl]-N-(4-cyclohexylphenyl)-2,4-dimethylaniline (PubChem CID 58690841) has the molecular formula C72H76N2 and a molecular weight of 969.41 g/mol. Its IUPAC name is N-[4-[6-[4-(4-cyclohexyl-N-(2,4-dimethylphenyl)anilino)phenyl]-9,10-di(propan-2-yl)anthracen-2-yl]phenyl]-N-(4-cyclohexylphenyl)-2,4-dimethylaniline.
| Compound Name | N-[4-[6-[4-(4-cyclohexyl-N-(2,4-dimethylphenyl)anilino)phenyl]-9,10-di(propan-2-yl)anthracen-2-yl]phenyl]-N-(4-cyclohexylphenyl)-2,4-dimethylaniline |
|---|---|
| PubChem CID | 58690841 |
| Molecular Formula | C72H76N2 |
| Molecular Weight | 969.41 g/mol |
| Exact Mass | 968.60 |
| IUPAC Name | N-[4-[6-[4-(4-cyclohexyl-N-(2,4-dimethylphenyl)anilino)phenyl]-9,10-di(propan-2-yl)anthracen-2-yl]phenyl]-N-(4-cyclohexylphenyl)-2,4-dimethylaniline |
| SMILES | Cc1ccc(N(c2ccc(-c3ccc4c(C(C)C)c5cc(-c6ccc(N(c7ccc(C8CCCCC8)cc7)c7ccc(C)cc7C)cc6)ccc5c(C(C)C)c4c3)cc2)c2ccc(C3CCCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C72H76N2/c1-47(2)71-65-39-29-60(58-27-37-64(38-28-58)74(70-42-20-50(6)44-52(70)8)62-33-23-56(24-34-62)54-17-13-10-14-18-54)46-68(65)72(48(3)4)66-40-30-59(45-67(66)71)57-25-35-63(36-26-57)73(69-41-19-49(5)43-51(69)7)61-31-21-55(22-32-61)53-15-11-9-12-16-53/h19-48,53-54H,9-18H2,1-8H3 |
| InChIKey | ILMWRGFMVXDXKM-UHFFFAOYSA-N |
| XLogP | 21.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.41 |
| LogP ≤ 5 | 21.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|