C27H17N3O4 — CID 58690923
6-(3,6-dimethyl-2-pyridinyl)-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 58690923) has the molecular formula C27H17N3O4 and a molecular weight of 447.45 g/mol. Its IUPAC name is 6-(3,6-dimethyl-2-pyridinyl)-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-(3,6-dimethyl-2-pyridinyl)-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 58690923 |
| Molecular Formula | C27H17N3O4 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 6-(3,6-dimethyl-2-pyridinyl)-13-phenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(c2ccccc2)C4=O)n1 |
| InChI | InChI=1S/C27H17N3O4/c1-14-8-9-15(2)28-23(14)30-26(33)19-12-10-17-21-18(11-13-20(22(19)21)27(30)34)25(32)29(24(17)31)16-6-4-3-5-7-16/h3-13H,1-2H3 |
| InChIKey | HGRRHEIGYSFKDP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|