About N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline
N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline (PubChem CID 58691489) has the molecular formula C30H30N4O2
and a molecular weight of 478.60 g/mol. Its IUPAC name is N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline.
Molecular Properties
| Compound Name | N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline |
| PubChem CID | 58691489 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline |
| SMILES | Cn1cc(C#CC(C)(C)C)c(-c2cc([N+](=O)[O-])ccc2N(Cc2ccccc2)Cc2ccccc2)n1 |
| InChI | InChI=1S/C30H30N4O2/c1-30(2,3)18-17-25-22-32(4)31-29(25)27-19-26(34(35)36)15-16-28(27)33(20-23-11-7-5-8-12-23)21-24-13-9-6-10-14-24/h5-16,19,22H,20-21H2,1-4H3 |
| InChIKey | KADKWEYBTVSSOZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline?
The IUPAC name of N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline (CID 58691489) is N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline.
What is the SMILES notation for N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline?
The canonical SMILES for N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline is Cn1cc(C#CC(C)(C)C)c(-c2cc([N+](=O)[O-])ccc2N(Cc2ccccc2)Cc2ccccc2)n1.
What is the InChIKey of N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline?
The InChIKey is KADKWEYBTVSSOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H30N4O2/c1-30(2,3)18-17-25-22-32(4)31-29(25)27-19-26(34(35)36)15-16-28(27)33(20-23-11-7-5-8-12-23)21-24-13-9-6-10-14-24/h5-16,19,22H,20-21H2,1-4H3.
What are the key properties of N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline?
N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline has a molecular weight of 478.60 g/mol, XLogP of 6.60, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibenzyl-2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroaniline is sourced from PubChem (CID 58691489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).