C37H44N8O4 — CID 58691500
N,N'-bis[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitrophenyl]-2,2-dimethylpropane-1,3-diamine (PubChem CID 58691500) has the molecular formula C37H44N8O4 and a molecular weight of 664.81 g/mol. Its IUPAC name is N,N'-bis[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitrophenyl]-2,2-dimethylpropane-1,3-diamine.
| Compound Name | N,N'-bis[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitrophenyl]-2,2-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 58691500 |
| Molecular Formula | C37H44N8O4 |
| Molecular Weight | 664.81 g/mol |
| Exact Mass | 664.35 |
| IUPAC Name | N,N'-bis[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitrophenyl]-2,2-dimethylpropane-1,3-diamine |
| SMILES | Cn1cc(C#CC(C)(C)C)c(-c2cc([N+](=O)[O-])ccc2NCC(C)(C)CNc2ccc([N+](=O)[O-])cc2-c2nn(C)cc2C#CC(C)(C)C)n1 |
| InChI | InChI=1S/C37H44N8O4/c1-35(2,3)17-15-25-21-42(9)40-33(25)29-19-27(44(46)47)11-13-31(29)38-23-37(7,8)24-39-32-14-12-28(45(48)49)20-30(32)34-26(22-43(10)41-34)16-18-36(4,5)6/h11-14,19-22,38-39H,23-24H2,1-10H3 |
| InChIKey | SBGVTIWIVBFRBR-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 145.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.81 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|