C34H38N8O4 — CID 58691506
N,N'-bis[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitrophenyl]ethane-1,2-diamine (PubChem CID 58691506) has the molecular formula C34H38N8O4 and a molecular weight of 622.73 g/mol. Its IUPAC name is N,N'-bis[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitrophenyl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitrophenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 58691506 |
| Molecular Formula | C34H38N8O4 |
| Molecular Weight | 622.73 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | N,N'-bis[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitrophenyl]ethane-1,2-diamine |
| SMILES | Cn1cc(C#CC(C)(C)C)c(-c2cc([N+](=O)[O-])ccc2NCCNc2ccc([N+](=O)[O-])cc2-c2nn(C)cc2C#CC(C)(C)C)n1 |
| InChI | InChI=1S/C34H38N8O4/c1-33(2,3)15-13-23-21-39(7)37-31(23)27-19-25(41(43)44)9-11-29(27)35-17-18-36-30-12-10-26(42(45)46)20-28(30)32-24(22-40(8)38-32)14-16-34(4,5)6/h9-12,19-22,35-36H,17-18H2,1-8H3 |
| InChIKey | LNDUSINLEIJJOW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 145.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.73 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|